C26H34BrNO4S2 — CID 44625944
(2R,3R,4S,5R)-2-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanyl-5-propylpyrrolidine-3-carboxylic acid (PubChem CID 44625944) has the molecular formula C26H34BrNO4S2 and a molecular weight of 568.60 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanyl-5-propylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S,5R)-2-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanyl-5-propylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 44625944 |
| Molecular Formula | C26H34BrNO4S2 |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-bromophenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanyl-5-propylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCS[C@H]1[C@@H](C(=O)O)[C@H](c2ccc(Br)cc2)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1CCC |
| InChI | InChI=1S/C26H34BrNO4S2/c1-4-6-7-17-33-25-22(8-5-2)28(34(31,32)21-15-9-18(3)10-16-21)24(23(25)26(29)30)19-11-13-20(27)14-12-19/h9-16,22-25H,4-8,17H2,1-3H3,(H,29,30)/t22-,23+,24+,25-/m1/s1 |
| InChIKey | CGFZBZQAMCKWGV-WSOYEBOPSA-N |
| XLogP | 6.66 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|