C12H9N5 — CID 44626289
2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene (PubChem CID 44626289) has the molecular formula C12H9N5 and a molecular weight of 223.24 g/mol. Its IUPAC name is 2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene.
| Compound Name | 2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 44626289 |
| Molecular Formula | C12H9N5 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,9,11,13,15-heptaene |
| SMILES | c1ccc2c(c1)-c1ncnn1Cc1cncn1-2 |
| InChI | InChI=1S/C12H9N5/c1-2-4-11-10(3-1)12-14-7-15-17(12)6-9-5-13-8-16(9)11/h1-5,7-8H,6H2 |
| InChIKey | AKRXCNKGZVHBKU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |