C23H26ClF2N5O2S — CID 44626293
6-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidamide (PubChem CID 44626293) has the molecular formula C23H26ClF2N5O2S and a molecular weight of 510.01 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidamide.
| Compound Name | 6-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidamide |
|---|---|
| PubChem CID | 44626293 |
| Molecular Formula | C23H26ClF2N5O2S |
| Molecular Weight | 510.01 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(4,4-difluoropiperidin-1-yl)sulfonyl-N'-methyl-5-phenyl-4,5-dihydro-3H-pyridazine-2-carboximidamide |
| SMILES | C/N=C(\NS(=O)(=O)N1CCC(F)(F)CC1)N1CCC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H26ClF2N5O2S/c1-27-22(29-34(32,33)30-15-12-23(25,26)13-16-30)31-14-11-20(17-5-3-2-4-6-17)21(28-31)18-7-9-19(24)10-8-18/h2-10,20H,11-16H2,1H3,(H,27,29) |
| InChIKey | BFMJMAMGDAILJQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.01 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|