C24H32O5 — CID 44626311
[(1R,3E,8S)-8-hydroperoxy-3,10,10-trimethyl-7-methylidenecycloundec-3-en-1-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 44626311) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(1R,3E,8S)-8-hydroperoxy-3,10,10-trimethyl-7-methylidenecycloundec-3-en-1-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,3E,8S)-8-hydroperoxy-3,10,10-trimethyl-7-methylidenecycloundec-3-en-1-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 44626311 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(1R,3E,8S)-8-hydroperoxy-3,10,10-trimethyl-7-methylidenecycloundec-3-en-1-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=C1CC/C=C(\C)C[C@H](OC(=O)/C=C/c2ccc(O)cc2)CC(C)(C)C[C@@H]1OO |
| InChI | InChI=1S/C24H32O5/c1-17-6-5-7-18(2)22(29-27)16-24(3,4)15-21(14-17)28-23(26)13-10-19-8-11-20(25)12-9-19/h6,8-13,21-22,25,27H,2,5,7,14-16H2,1,3-4H3/b13-10+,17-6+/t21-,22-/m0/s1 |
| InChIKey | ZDRHNSQPEYXBDI-BBVNVTRHSA-N |
| XLogP | 5.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|