C20H24N4Pt — CID 44626415
[(1R,2R)-2-azanidylcyclohexyl]azanide;5,6-dimethyl-1,10-phenanthroline;platinum(2+) (PubChem CID 44626415) has the molecular formula C20H24N4Pt and a molecular weight of 515.52 g/mol. Its IUPAC name is [(1R,2R)-2-azanidylcyclohexyl]azanide;5,6-dimethyl-1,10-phenanthroline;platinum(2+).
| Compound Name | [(1R,2R)-2-azanidylcyclohexyl]azanide;5,6-dimethyl-1,10-phenanthroline;platinum(2+) |
|---|---|
| PubChem CID | 44626415 |
| Molecular Formula | C20H24N4Pt |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | [(1R,2R)-2-azanidylcyclohexyl]azanide;5,6-dimethyl-1,10-phenanthroline;platinum(2+) |
| SMILES | Cc1c(C)c2cccnc2c2ncccc12.[NH-][C@@H]1CCCC[C@H]1[NH-].[Pt+2] |
| InChI | InChI=1S/C14H12N2.C6H12N2.Pt/c1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13;7-5-3-1-2-4-6(5)8;/h3-8H,1-2H3;5-8H,1-4H2;/q;-2;+2/t;5-,6-;/m.1./s1 |
| InChIKey | LFRUWKVHWXTOQR-JGHXHLRYSA-N |
| XLogP | 5.80 |
| TPSA | 73.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|