C17H29NO — CID 44626447
(E,E)-N-butoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine (PubChem CID 44626447) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is (E,E)-N-butoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine.
| Compound Name | (E,E)-N-butoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 44626447 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (E,E)-N-butoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
| SMILES | CCCCO/N=C(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C17H29NO/c1-6-7-13-19-18-15(3)10-11-16-14(2)9-8-12-17(16,4)5/h9-11,16H,6-8,12-13H2,1-5H3/b11-10+,18-15+ |
| InChIKey | RZBLAEDHVXNGPL-LNCIWOMLSA-N |
| XLogP | 5.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|