C19H33NO — CID 44626455
(E,E)-N-hexoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine (PubChem CID 44626455) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (E,E)-N-hexoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine.
| Compound Name | (E,E)-N-hexoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 44626455 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (E,E)-N-hexoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
| SMILES | CCCCCCO/N=C(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C19H33NO/c1-6-7-8-9-15-21-20-17(3)12-13-18-16(2)11-10-14-19(18,4)5/h11-13,18H,6-10,14-15H2,1-5H3/b13-12+,20-17+ |
| InChIKey | RPIJHPOEEDTBPG-UBZACWCHSA-N |
| XLogP | 5.90 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|