C37H46N4O2 — CID 44626476
(1R,2R,4R,5Z,12R,13S,16Z)-25-(6-methoxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol (PubChem CID 44626476) has the molecular formula C37H46N4O2 and a molecular weight of 578.80 g/mol. Its IUPAC name is (1R,2R,4R,5Z,12R,13S,16Z)-25-(6-methoxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol.
| Compound Name | (1R,2R,4R,5Z,12R,13S,16Z)-25-(6-methoxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
|---|---|
| PubChem CID | 44626476 |
| Molecular Formula | C37H46N4O2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | (1R,2R,4R,5Z,12R,13S,16Z)-25-(6-methoxy-9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
| SMILES | COc1ccc2[nH]c3c(C4=C[C@@]5(O)CC/C=C\CCCCN6CC[C@@H]4[C@]4(C[C@@H]7/C=C\CCCCN7[C@H]45)C6)nccc3c2c1 |
| InChI | InChI=1S/C37H46N4O2/c1-43-27-13-14-32-29(22-27)28-15-18-38-33(34(28)39-32)30-24-37(42)17-9-5-2-3-6-10-19-40-21-16-31(30)36(25-40)23-26-12-8-4-7-11-20-41(26)35(36)37/h2,5,8,12-15,18,22,24,26,31,35,39,42H,3-4,6-7,9-11,16-17,19-21,23,25H2,1H3/b5-2-,12-8-/t26-,31-,35+,36-,37-/m0/s1 |
| InChIKey | FNRVMLFYIIGIFD-URZPCCFDSA-N |
| XLogP | 6.86 |
| TPSA | 64.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|