C24H28IN3O — CID 44626534
1-(4-iodophenyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea (PubChem CID 44626534) has the molecular formula C24H28IN3O and a molecular weight of 501.41 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea.
| Compound Name | 1-(4-iodophenyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea |
|---|---|
| PubChem CID | 44626534 |
| Molecular Formula | C24H28IN3O |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 1-(4-iodophenyl)-3-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]urea |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(NC(=O)Nc2ccc(I)cc2)cc13 |
| InChI | InChI=1S/C24H28IN3O/c1-28-13-12-24-11-3-2-4-20(24)22(28)14-16-5-8-19(15-21(16)24)27-23(29)26-18-9-6-17(25)7-10-18/h5-10,15,20,22H,2-4,11-14H2,1H3,(H2,26,27,29)/t20-,22+,24+/m0/s1 |
| InChIKey | PNKGWKXKIPIROR-BGWNEDDSSA-N |
| XLogP | 5.62 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|