C28H34IN3O — CID 44626538
1-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-3-(4-iodophenyl)urea (PubChem CID 44626538) has the molecular formula C28H34IN3O and a molecular weight of 555.50 g/mol. Its IUPAC name is 1-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-3-(4-iodophenyl)urea.
| Compound Name | 1-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-3-(4-iodophenyl)urea |
|---|---|
| PubChem CID | 44626538 |
| Molecular Formula | C28H34IN3O |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 1-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-3-(4-iodophenyl)urea |
| SMILES | O=C(Nc1ccc(I)cc1)Nc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C28H34IN3O/c29-21-8-11-22(12-9-21)30-27(33)31-23-10-7-20-16-26-24-6-1-2-13-28(24,25(20)17-23)14-15-32(26)18-19-4-3-5-19/h7-12,17,19,24,26H,1-6,13-16,18H2,(H2,30,31,33)/t24-,26+,28+/m0/s1 |
| InChIKey | JNWVOPIDONHTEO-DKRHUIDYSA-N |
| XLogP | 6.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|