C21H37NO — CID 44626561
(E,E)-N-octoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine (PubChem CID 44626561) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is (E,E)-N-octoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine.
| Compound Name | (E,E)-N-octoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 44626561 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | (E,E)-N-octoxy-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-imine |
| SMILES | CCCCCCCCO/N=C(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C21H37NO/c1-6-7-8-9-10-11-17-23-22-19(3)14-15-20-18(2)13-12-16-21(20,4)5/h13-15,20H,6-12,16-17H2,1-5H3/b15-14+,22-19+ |
| InChIKey | YTWLKAPPNGELQH-FZNYFPLJSA-N |
| XLogP | 6.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|