C21H29NO — CID 44626619
(1-pentylindol-3-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 44626619) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (1-pentylindol-3-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | (1-pentylindol-3-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 44626619 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (1-pentylindol-3-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CCCCCn1cc(C(=O)C2C(C)(C)C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H29NO/c1-6-7-10-13-22-14-16(15-11-8-9-12-17(15)22)18(23)19-20(2,3)21(19,4)5/h8-9,11-12,14,19H,6-7,10,13H2,1-5H3 |
| InChIKey | NBMMIBNZVQFQEO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|