C23H38O3 — CID 44626665
(2R,4aS,4bR,7S,10aS)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-2-ol (PubChem CID 44626665) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (2R,4aS,4bR,7S,10aS)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-2-ol.
| Compound Name | (2R,4aS,4bR,7S,10aS)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-2-ol |
|---|---|
| PubChem CID | 44626665 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (2R,4aS,4bR,7S,10aS)-7-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-2-ol |
| SMILES | CC1(C)OCC([C@]2(C)C=C3CC[C@@H]4C(C)(C)[C@H](O)CC[C@@]4(C)[C@@H]3CC2)O1 |
| InChI | InChI=1S/C23H38O3/c1-20(2)17-8-7-15-13-22(5,19-14-25-21(3,4)26-19)11-9-16(15)23(17,6)12-10-18(20)24/h13,16-19,24H,7-12,14H2,1-6H3/t16-,17-,18-,19?,22+,23+/m1/s1 |
| InChIKey | FJZIWOWYBFGDBI-VICPIZHKSA-N |
| XLogP | 5.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|