C15H15N3O4S — CID 44626757
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 44626757) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 44626757 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2ccc3c(-c4cccs4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H15N3O4S/c19-6-9-12(20)13(21)15(22-9)18-4-3-8-11(10-2-1-5-23-10)16-7-17-14(8)18/h1-5,7,9,12-13,15,19-21H,6H2/t9-,12-,13-,15-/m1/s1 |
| InChIKey | YBUBCHDFOGAWME-QGMIFYJMSA-N |
| XLogP | 0.77 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |