C24H27N3O5 — CID 44626822
(6S)-6-[[4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 44626822) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is (6S)-6-[[4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-6-[[4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 44626822 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (6S)-6-[[4-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]phenyl]methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | CC(C)(C)OCc1ccc(-c2ccc(CO[C@@H]3COc4nc([N+](=O)[O-])cn4C3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O5/c1-24(2,3)32-15-18-6-10-20(11-7-18)19-8-4-17(5-9-19)14-30-21-12-26-13-22(27(28)29)25-23(26)31-16-21/h4-11,13,21H,12,14-16H2,1-3H3/t21-/m0/s1 |
| InChIKey | VBDQRQKTKYAJTA-NRFANRHFSA-N |
| XLogP | 4.75 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|