C15H14ClN3O4S — CID 44626852
(2R,3R,4S,5R)-2-(5-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 44626852) has the molecular formula C15H14ClN3O4S and a molecular weight of 367.81 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(5-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(5-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 44626852 |
| Molecular Formula | C15H14ClN3O4S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (2R,3R,4S,5R)-2-(5-chloro-4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cc(Cl)c3c(-c4cccs4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H14ClN3O4S/c16-7-4-19(15-13(22)12(21)8(5-20)23-15)14-10(7)11(17-6-18-14)9-2-1-3-24-9/h1-4,6,8,12-13,15,20-22H,5H2/t8-,12-,13-,15-/m1/s1 |
| InChIKey | MHXRIGWUBLQBSC-AXTGTSHSSA-N |
| XLogP | 1.42 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |