C20H26N2O2 — CID 44626861
(15S,17R,19S)-15-ethyl-17-methoxy-11-oxido-1-aza-11-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene (PubChem CID 44626861) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (15S,17R,19S)-15-ethyl-17-methoxy-11-oxido-1-aza-11-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene.
| Compound Name | (15S,17R,19S)-15-ethyl-17-methoxy-11-oxido-1-aza-11-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene |
|---|---|
| PubChem CID | 44626861 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (15S,17R,19S)-15-ethyl-17-methoxy-11-oxido-1-aza-11-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene |
| SMILES | CC[C@]12CCC[N+]3([O-])CCc4c(n(c5ccccc45)[C@H](OC)C1)[C@H]23 |
| InChI | InChI=1S/C20H26N2O2/c1-3-20-10-6-11-22(23)12-9-15-14-7-4-5-8-16(14)21(17(13-20)24-2)18(15)19(20)22/h4-5,7-8,17,19H,3,6,9-13H2,1-2H3/t17-,19-,20+,22?/m1/s1 |
| InChIKey | KFAHAKAGWDLBIH-VIXCBWPKSA-N |
| XLogP | 4.29 |
| TPSA | 37.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|