C26H38N4O6 — CID 44626896
(2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-hydroxy-3-phenylmethoxycyclohexyl]oxy-4-phenylmethoxyoxan-3-ol (PubChem CID 44626896) has the molecular formula C26H38N4O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-hydroxy-3-phenylmethoxycyclohexyl]oxy-4-phenylmethoxyoxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-hydroxy-3-phenylmethoxycyclohexyl]oxy-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 44626896 |
| Molecular Formula | C26H38N4O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (2R,3R,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-hydroxy-3-phenylmethoxycyclohexyl]oxy-4-phenylmethoxyoxan-3-ol |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](OCc3ccccc3)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C26H38N4O6/c27-12-19-21(31)25(34-14-16-9-5-2-6-10-16)20(30)26(35-19)36-24-18(29)11-17(28)23(22(24)32)33-13-15-7-3-1-4-8-15/h1-10,17-26,31-32H,11-14,27-30H2/t17-,18+,19-,20-,21-,22-,23+,24-,25-,26-/m1/s1 |
| InChIKey | FYDXTTYTQZKNDB-JQGYJCLESA-N |
| XLogP | -0.67 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |