C20H19N3O2S2 — CID 44627002
1-[6-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-pyridinyl]-3,3-diethylazetidine-2,4-dione (PubChem CID 44627002) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 1-[6-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-pyridinyl]-3,3-diethylazetidine-2,4-dione.
| Compound Name | 1-[6-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-pyridinyl]-3,3-diethylazetidine-2,4-dione |
|---|---|
| PubChem CID | 44627002 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-[6-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-pyridinyl]-3,3-diethylazetidine-2,4-dione |
| SMILES | CCC1(CC)C(=O)N(c2ccc(CSc3nc4ccccc4s3)nc2)C1=O |
| InChI | InChI=1S/C20H19N3O2S2/c1-3-20(4-2)17(24)23(18(20)25)14-10-9-13(21-11-14)12-26-19-22-15-7-5-6-8-16(15)27-19/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | JFPNWBUMOOBFCD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|