C21H21N3O6 — CID 44627011
2-[4-[4-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]phenyl]phenoxy]ethanol (PubChem CID 44627011) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-[4-[4-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]phenyl]phenoxy]ethanol.
| Compound Name | 2-[4-[4-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]phenyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 44627011 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[4-[4-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]phenyl]phenoxy]ethanol |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(-c3ccc(OCCO)cc3)cc1)C2 |
| InChI | InChI=1S/C21H21N3O6/c25-9-10-28-18-7-5-17(6-8-18)16-3-1-15(2-4-16)13-29-19-11-23-12-20(24(26)27)22-21(23)30-14-19/h1-8,12,19,25H,9-11,13-14H2/t19-/m0/s1 |
| InChIKey | MNAVIKABFCOSPW-IBGZPJMESA-N |
| XLogP | 2.81 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|