About [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid
[5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid (PubChem CID 44627140) has the molecular formula C15H16Br2N3O4P
and a molecular weight of 493.09 g/mol. Its IUPAC name is [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid |
| PubChem CID | 44627140 |
| Molecular Formula | C15H16Br2N3O4P |
| Molecular Weight | 493.09 g/mol |
| Exact Mass | 490.92 |
| IUPAC Name | [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid |
| SMILES | CC(C)Cn1c(-c2ccc(P(=O)(O)O)o2)nc2c(N)c(Br)cc(Br)c21 |
| InChI | InChI=1S/C15H16Br2N3O4P/c1-7(2)6-20-14-9(17)5-8(16)12(18)13(14)19-15(20)10-3-4-11(24-10)25(21,22)23/h3-5,7H,6,18H2,1-2H3,(H2,21,22,23) |
| InChIKey | RXZNCHCSXGCWNX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.09 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
The IUPAC name of [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid (CID 44627140) is [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid.
What is the SMILES notation for [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
The canonical SMILES for [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid is CC(C)Cn1c(-c2ccc(P(=O)(O)O)o2)nc2c(N)c(Br)cc(Br)c21.
What is the InChIKey of [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
The InChIKey is RXZNCHCSXGCWNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Br2N3O4P/c1-7(2)6-20-14-9(17)5-8(16)12(18)13(14)19-15(20)10-3-4-11(24-10)25(21,22)23/h3-5,7H,6,18H2,1-2H3,(H2,21,22,23).
What are the key properties of [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
[5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid has a molecular weight of 493.09 g/mol, XLogP of 3.86, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-amino-5,7-dibromo-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid is sourced from PubChem (CID 44627140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).