C33H44N4O6 — CID 44627196
(1R,2R,3S,5R,6S)-3,5-diamino-2-[(2R,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol (PubChem CID 44627196) has the molecular formula C33H44N4O6 and a molecular weight of 592.74 g/mol. Its IUPAC name is (1R,2R,3S,5R,6S)-3,5-diamino-2-[(2R,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol.
| Compound Name | (1R,2R,3S,5R,6S)-3,5-diamino-2-[(2R,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 44627196 |
| Molecular Formula | C33H44N4O6 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | (1R,2R,3S,5R,6S)-3,5-diamino-2-[(2R,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](OCc3ccccc3)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H44N4O6/c34-17-26-31(40-19-22-12-6-2-7-13-22)32(41-20-23-14-8-3-9-15-23)27(37)33(42-26)43-30-25(36)16-24(35)29(28(30)38)39-18-21-10-4-1-5-11-21/h1-15,24-33,38H,16-20,34-37H2/t24-,25+,26-,27-,28-,29+,30-,31-,32-,33-/m1/s1 |
| InChIKey | KFSMAOGZLUUDER-GYOPUMEISA-N |
| XLogP | 1.56 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |