C20H15Cl2NO3 — CID 44627375
3-(3,4-dichloroanilino)-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione (PubChem CID 44627375) has the molecular formula C20H15Cl2NO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is 3-(3,4-dichloroanilino)-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione.
| Compound Name | 3-(3,4-dichloroanilino)-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 44627375 |
| Molecular Formula | C20H15Cl2NO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 3-(3,4-dichloroanilino)-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione |
| SMILES | CC1(C)OC2=C(C(=O)C(=O)c3ccccc32)C1Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2NO3/c1-20(2)19(23-10-7-8-13(21)14(22)9-10)15-17(25)16(24)11-5-3-4-6-12(11)18(15)26-20/h3-9,19,23H,1-2H3 |
| InChIKey | JQBACNZPACERKS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|