C23H19N3O4 — CID 44627445
(6S)-6-[(2-naphthalen-2-ylphenyl)methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 44627445) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is (6S)-6-[(2-naphthalen-2-ylphenyl)methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-6-[(2-naphthalen-2-ylphenyl)methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 44627445 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (6S)-6-[(2-naphthalen-2-ylphenyl)methoxy]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccccc1-c1ccc3ccccc3c1)C2 |
| InChI | InChI=1S/C23H19N3O4/c27-26(28)22-13-25-12-20(15-30-23(25)24-22)29-14-19-7-3-4-8-21(19)18-10-9-16-5-1-2-6-17(16)11-18/h1-11,13,20H,12,14-15H2/t20-/m0/s1 |
| InChIKey | RJODRYCXYIZREL-FQEVSTJZSA-N |
| XLogP | 4.59 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|