C15H20O3 — CID 44627499
(4aS,8R,8aR,9aS)-8-hydroxy-3,5,8a-trimethyl-4,4a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one (PubChem CID 44627499) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4aS,8R,8aR,9aS)-8-hydroxy-3,5,8a-trimethyl-4,4a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (4aS,8R,8aR,9aS)-8-hydroxy-3,5,8a-trimethyl-4,4a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 44627499 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4aS,8R,8aR,9aS)-8-hydroxy-3,5,8a-trimethyl-4,4a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=CC[C@@H](O)[C@]2(C)C[C@@H]3OC(=O)C(C)=C3C[C@@H]12 |
| InChI | InChI=1S/C15H20O3/c1-8-4-5-13(16)15(3)7-12-10(6-11(8)15)9(2)14(17)18-12/h4,11-13,16H,5-7H2,1-3H3/t11-,12-,13+,15+/m0/s1 |
| InChIKey | USNIKHVJRCUVQY-RMRHIDDWSA-N |
| XLogP | 2.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|