C16H24O4 — CID 44627605
(1R,4aS,6aR,8S,10aS,10bR)-1-hydroxy-1-(hydroxymethyl)-8,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-2-one (PubChem CID 44627605) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1R,4aS,6aR,8S,10aS,10bR)-1-hydroxy-1-(hydroxymethyl)-8,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-2-one.
| Compound Name | (1R,4aS,6aR,8S,10aS,10bR)-1-hydroxy-1-(hydroxymethyl)-8,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-2-one |
|---|---|
| PubChem CID | 44627605 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1R,4aS,6aR,8S,10aS,10bR)-1-hydroxy-1-(hydroxymethyl)-8,10b-dimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-2-one |
| SMILES | C[C@H]1CC[C@H]2[C@@H](C=C[C@@H]3COC(=O)[C@](O)(CO)[C@@]32C)C1 |
| InChI | InChI=1S/C16H24O4/c1-10-3-6-13-11(7-10)4-5-12-8-20-14(18)16(19,9-17)15(12,13)2/h4-5,10-13,17,19H,3,6-9H2,1-2H3/t10-,11-,12+,13-,15-,16+/m0/s1 |
| InChIKey | JDKSFOWBWOHISV-RBBOIFPTSA-N |
| XLogP | 1.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|