C19H24BN3O6 — CID 44627665
(6S)-2-nitro-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 44627665) has the molecular formula C19H24BN3O6 and a molecular weight of 401.23 g/mol. Its IUPAC name is (6S)-2-nitro-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-2-nitro-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 44627665 |
| Molecular Formula | C19H24BN3O6 |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (6S)-2-nitro-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | CC1(C)OB(c2ccc(CO[C@@H]3COc4nc([N+](=O)[O-])cn4C3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H24BN3O6/c1-18(2)19(3,4)29-20(28-18)14-7-5-13(6-8-14)11-26-15-9-22-10-16(23(24)25)21-17(22)27-12-15/h5-8,10,15H,9,11-12H2,1-4H3/t15-/m0/s1 |
| InChIKey | RGOVMELSEFXKIM-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 97.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|