C27H33IN2 — CID 44627680
(1R,9R,10R)-17-(cyclopropylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 44627680) has the molecular formula C27H33IN2 and a molecular weight of 512.48 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclopropylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-17-(cyclopropylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 44627680 |
| Molecular Formula | C27H33IN2 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (1R,9R,10R)-17-(cyclopropylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | Ic1ccc(CNc2ccc3c(c2)[C@@]24CCCC[C@H]2[C@@H](C3)N(CC2CC2)CC4)cc1 |
| InChI | InChI=1S/C27H33IN2/c28-22-9-6-19(7-10-22)17-29-23-11-8-21-15-26-24-3-1-2-12-27(24,25(21)16-23)13-14-30(26)18-20-4-5-20/h6-11,16,20,24,26,29H,1-5,12-15,17-18H2/t24-,26+,27+/m0/s1 |
| InChIKey | JVNZGKUQEQMIMB-WYMJOSIYSA-N |
| XLogP | 6.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|