C16H23N3O13P2 — CID 44627805
azane;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (4-methoxyphenyl) hydrogen phosphate (PubChem CID 44627805) has the molecular formula C16H23N3O13P2 and a molecular weight of 527.32 g/mol. Its IUPAC name is azane;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (4-methoxyphenyl) hydrogen phosphate.
| Compound Name | azane;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (4-methoxyphenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 44627805 |
| Molecular Formula | C16H23N3O13P2 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | azane;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (4-methoxyphenyl) hydrogen phosphate |
| SMILES | COc1ccc(OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)cc1.N |
| InChI | InChI=1S/C16H20N2O13P2.H3N/c1-27-9-2-4-10(5-3-9)30-33(25,26)31-32(23,24)28-8-11-13(20)14(21)15(29-11)18-7-6-12(19)17-16(18)22;/h2-7,11,13-15,20-21H,8H2,1H3,(H,23,24)(H,25,26)(H,17,19,22);1H3/t11-,13-,14-,15-;/m1./s1 |
| InChIKey | NGJDHTAKGAEQBP-MOAMTLHQSA-N |
| XLogP | -0.36 |
| TPSA | 251.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|