C23H15Cl2F3N2O3S2 — CID 44627829
(E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide (PubChem CID 44627829) has the molecular formula C23H15Cl2F3N2O3S2 and a molecular weight of 559.42 g/mol. Its IUPAC name is (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide.
| Compound Name | (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 44627829 |
| Molecular Formula | C23H15Cl2F3N2O3S2 |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | (E)-N-(4,5-dichlorothiophen-2-yl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide |
| SMILES | Cc1cn(Cc2ccc(F)c(F)c2)c2c(/C=C/C(=O)NS(=O)(=O)c3cc(Cl)c(Cl)s3)cc(F)cc12 |
| InChI | InChI=1S/C23H15Cl2F3N2O3S2/c1-12-10-30(11-13-2-4-18(27)19(28)6-13)22-14(7-15(26)8-16(12)22)3-5-20(31)29-35(32,33)21-9-17(24)23(25)34-21/h2-10H,11H2,1H3,(H,29,31)/b5-3+ |
| InChIKey | QXOGNWFHBAWCDN-HWKANZROSA-N |
| XLogP | 6.30 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|