C40H52N4O — CID 44627836
(1R,2R,4R,5Z,12R,13S,16Z)-25-(9-butylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol (PubChem CID 44627836) has the molecular formula C40H52N4O and a molecular weight of 604.88 g/mol. Its IUPAC name is (1R,2R,4R,5Z,12R,13S,16Z)-25-(9-butylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol.
| Compound Name | (1R,2R,4R,5Z,12R,13S,16Z)-25-(9-butylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
|---|---|
| PubChem CID | 44627836 |
| Molecular Formula | C40H52N4O |
| Molecular Weight | 604.88 g/mol |
| Exact Mass | 604.41 |
| IUPAC Name | (1R,2R,4R,5Z,12R,13S,16Z)-25-(9-butylpyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
| SMILES | CCCCn1c2ccccc2c2ccnc(C3=C[C@@]4(O)CC/C=C\CCCCN5CC[C@@H]3[C@]3(C[C@@H]6/C=C\CCCCN6[C@H]34)C5)c21 |
| InChI | InChI=1S/C40H52N4O/c1-2-3-24-44-35-18-12-11-17-31(35)32-19-22-41-36(37(32)44)33-28-40(45)21-13-7-4-5-8-14-23-42-26-20-34(33)39(29-42)27-30-16-10-6-9-15-25-43(30)38(39)40/h4,7,10-12,16-19,22,28,30,34,38,45H,2-3,5-6,8-9,13-15,20-21,23-27,29H2,1H3/b7-4-,16-10-/t30-,34-,38+,39-,40-/m0/s1 |
| InChIKey | IBJNOMORYJAHAC-OXLPRPDYSA-N |
| XLogP | 8.13 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.88 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|