C19H17N3O4 — CID 44627875
(6S)-2-nitro-6-[(4-phenylphenyl)methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 44627875) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (6S)-2-nitro-6-[(4-phenylphenyl)methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-2-nitro-6-[(4-phenylphenyl)methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 44627875 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (6S)-2-nitro-6-[(4-phenylphenyl)methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(-c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C19H17N3O4/c23-22(24)18-11-21-10-17(13-26-19(21)20-18)25-12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,11,17H,10,12-13H2/t17-/m0/s1 |
| InChIKey | NJHKWPMIXFRSEE-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|