C27H44FNO — CID 44628203
(NE)-N-[(2R,8S,9S,10R,13R,14S,17R)-2-fluoro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine (PubChem CID 44628203) has the molecular formula C27H44FNO and a molecular weight of 417.65 g/mol. Its IUPAC name is (NE)-N-[(2R,8S,9S,10R,13R,14S,17R)-2-fluoro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2R,8S,9S,10R,13R,14S,17R)-2-fluoro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 44628203 |
| Molecular Formula | C27H44FNO |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | (NE)-N-[(2R,8S,9S,10R,13R,14S,17R)-2-fluoro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=C/C(=N\O)[C@H](F)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44FNO/c1-17(2)7-6-8-18(3)21-11-12-22-20-10-9-19-15-25(29-30)24(28)16-27(19,5)23(20)13-14-26(21,22)4/h15,17-18,20-24,30H,6-14,16H2,1-5H3/b29-25+/t18-,20+,21-,22+,23+,24-,26-,27+/m1/s1 |
| InChIKey | BPBWPSAWOQNEKC-SEMJUIBHSA-N |
| XLogP | 7.81 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|