C21H17Cl4F3N2O2 — CID 44628300
N-[[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]butanamide (PubChem CID 44628300) has the molecular formula C21H17Cl4F3N2O2 and a molecular weight of 528.19 g/mol. Its IUPAC name is N-[[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]butanamide.
| Compound Name | N-[[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 44628300 |
| Molecular Formula | C21H17Cl4F3N2O2 |
| Molecular Weight | 528.19 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | N-[[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]butanamide |
| SMILES | CCCC(=O)NCc1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C21H17Cl4F3N2O2/c1-2-3-18(31)29-10-12-5-4-11(6-14(12)22)17-9-20(32-30-17,21(26,27)28)13-7-15(23)19(25)16(24)8-13/h4-8H,2-3,9-10H2,1H3,(H,29,31) |
| InChIKey | WQJLJKLHQTUPFF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.19 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|