About 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 44628823) has the molecular formula C14H20N2O6
and a molecular weight of 312.32 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid |
| PubChem CID | 44628823 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | CN1C(=O)CC[C@H]1C(=O)O.Cc1ncc(CO)c(CO)c1O |
| InChI | InChI=1S/C8H11NO3.C6H9NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5;1-7-4(6(9)10)2-3-5(7)8/h2,10-12H,3-4H2,1H3;4H,2-3H2,1H3,(H,9,10)/t;4-/m.0/s1 |
| InChIKey | JHKQIDKEOJKXGJ-VWMHFEHESA-N |
| XLogP | -0.23 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid?
The IUPAC name of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid (CID 44628823) is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid.
What is the SMILES notation for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid?
The canonical SMILES for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid is CN1C(=O)CC[C@H]1C(=O)O.Cc1ncc(CO)c(CO)c1O.
What is the InChIKey of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid?
The InChIKey is JHKQIDKEOJKXGJ-VWMHFEHESA-N. The full InChI is InChI=1S/C8H11NO3.C6H9NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5;1-7-4(6(9)10)2-3-5(7)8/h2,10-12H,3-4H2,1H3;4H,2-3H2,1H3,(H,9,10)/t;4-/m.0/s1.
What are the key properties of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid?
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid has a molecular weight of 312.32 g/mol, XLogP of -0.23, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;(2S)-1-methyl-5-oxopyrrolidine-2-carboxylic acid is sourced from PubChem (CID 44628823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).