C20H23F2N7O3 — CID 44628953
8-[(3,4-difluorophenyl)methyl]-6-methyl-3-(3-piperazin-1-ylpropoxy)pyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 44628953) has the molecular formula C20H23F2N7O3 and a molecular weight of 447.45 g/mol. Its IUPAC name is 8-[(3,4-difluorophenyl)methyl]-6-methyl-3-(3-piperazin-1-ylpropoxy)pyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 8-[(3,4-difluorophenyl)methyl]-6-methyl-3-(3-piperazin-1-ylpropoxy)pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 44628953 |
| Molecular Formula | C20H23F2N7O3 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 8-[(3,4-difluorophenyl)methyl]-6-methyl-3-(3-piperazin-1-ylpropoxy)pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)c2nc(OCCCN3CCNCC3)nnc2n(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C20H23F2N7O3/c1-27-18(30)16-17(29(20(27)31)12-13-3-4-14(21)15(22)11-13)25-26-19(24-16)32-10-2-7-28-8-5-23-6-9-28/h3-4,11,23H,2,5-10,12H2,1H3 |
| InChIKey | TWTVBSMQLKPTKM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|