C22H28F3N3O2+2 — CID 44629476
[(2R)-4-[2-[(S)-hydroxy(phenyl)methyl]diazepan-2-ium-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]azanium (PubChem CID 44629476) has the molecular formula C22H28F3N3O2+2 and a molecular weight of 423.48 g/mol. Its IUPAC name is [(2R)-4-[2-[(S)-hydroxy(phenyl)methyl]diazepan-2-ium-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]azanium.
| Compound Name | [(2R)-4-[2-[(S)-hydroxy(phenyl)methyl]diazepan-2-ium-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]azanium |
|---|---|
| PubChem CID | 44629476 |
| Molecular Formula | C22H28F3N3O2+2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | [(2R)-4-[2-[(S)-hydroxy(phenyl)methyl]diazepan-2-ium-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]azanium |
| SMILES | [NH3+][C@@H](CC(=O)N1CCCCC[NH+]1[C@@H](O)c1ccccc1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H26F3N3O2/c23-18-14-20(25)19(24)12-16(18)11-17(26)13-21(29)27-9-5-2-6-10-28(27)22(30)15-7-3-1-4-8-15/h1,3-4,7-8,12,14,17,22,30H,2,5-6,9-11,13,26H2/p+2/t17-,22+/m1/s1 |
| InChIKey | PYIBISLIAXBJQU-VGSWGCGISA-P |
| XLogP | 1.15 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|