C10H8F2O14P2-6 — CID 44629494
(3R,4S,5R)-5-[(1R)-1-carboxylato-2,2-difluoro-1-phosphonatooxyethoxy]-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate (PubChem CID 44629494) has the molecular formula C10H8F2O14P2-6 and a molecular weight of 452.10 g/mol. Its IUPAC name is (3R,4S,5R)-5-[(1R)-1-carboxylato-2,2-difluoro-1-phosphonatooxyethoxy]-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate.
| Compound Name | (3R,4S,5R)-5-[(1R)-1-carboxylato-2,2-difluoro-1-phosphonatooxyethoxy]-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 44629494 |
| Molecular Formula | C10H8F2O14P2-6 |
| Molecular Weight | 452.10 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | (3R,4S,5R)-5-[(1R)-1-carboxylato-2,2-difluoro-1-phosphonatooxyethoxy]-4-hydroxy-3-phosphonatooxycyclohexene-1-carboxylate |
| SMILES | O=C([O-])C1=C[C@@H](OP(=O)([O-])[O-])[C@@H](O)[C@H](O[C@@](OP(=O)([O-])[O-])(C(=O)[O-])C(F)F)C1 |
| InChI | InChI=1S/C10H14F2O14P2/c11-8(12)10(9(16)17,26-28(21,22)23)24-4-1-3(7(14)15)2-5(6(4)13)25-27(18,19)20/h2,4-6,8,13H,1H2,(H,14,15)(H,16,17)(H2,18,19,20)(H2,21,22,23)/p-6/t4-,5-,6+,10+/m1/s1 |
| InChIKey | OHXHNRRSMKIHDJ-VFWNUGQXSA-H |
| XLogP | -6.42 |
| TPSA | 254.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.10 |
| LogP ≤ 5 | -6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|