About 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate
4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate (PubChem CID 44629541) has the molecular formula C21H12N3O4-
and a molecular weight of 370.34 g/mol. Its IUPAC name is 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate.
Molecular Properties
| Compound Name | 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate |
| PubChem CID | 44629541 |
| Molecular Formula | C21H12N3O4- |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate |
| SMILES | O=C([O-])c1ccc(-c2cc3cccnc3c(-c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C21H13N3O4/c25-21(26)14-8-6-13(7-9-14)18-12-16-4-2-10-22-19(16)20(23-18)15-3-1-5-17(11-15)24(27)28/h1-12H,(H,25,26)/p-1 |
| InChIKey | QTNUWEKKZHSUQO-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 109.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate?
The IUPAC name of 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate (CID 44629541) is 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate.
What is the SMILES notation for 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate?
The canonical SMILES for 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate is O=C([O-])c1ccc(-c2cc3cccnc3c(-c3cccc([N+](=O)[O-])c3)n2)cc1.
What is the InChIKey of 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate?
The InChIKey is QTNUWEKKZHSUQO-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H13N3O4/c25-21(26)14-8-6-13(7-9-14)18-12-16-4-2-10-22-19(16)20(23-18)15-3-1-5-17(11-15)24(27)28/h1-12H,(H,25,26)/p-1.
What are the key properties of 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate?
4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate has a molecular weight of 370.34 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[8-(3-nitrophenyl)-1,7-naphthyridin-6-yl]benzoate is sourced from PubChem (CID 44629541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).