C25H44N3O5+ — CID 44629574
[(2R,4S,5S,7R)-8-(butylamino)-5-hydroxy-1-[[2-(3-methoxypropoxy)benzoyl]amino]-2,7-dimethyl-8-oxooctan-4-yl]azanium (PubChem CID 44629574) has the molecular formula C25H44N3O5+ and a molecular weight of 466.64 g/mol. Its IUPAC name is [(2R,4S,5S,7R)-8-(butylamino)-5-hydroxy-1-[[2-(3-methoxypropoxy)benzoyl]amino]-2,7-dimethyl-8-oxooctan-4-yl]azanium.
| Compound Name | [(2R,4S,5S,7R)-8-(butylamino)-5-hydroxy-1-[[2-(3-methoxypropoxy)benzoyl]amino]-2,7-dimethyl-8-oxooctan-4-yl]azanium |
|---|---|
| PubChem CID | 44629574 |
| Molecular Formula | C25H44N3O5+ |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | [(2R,4S,5S,7R)-8-(butylamino)-5-hydroxy-1-[[2-(3-methoxypropoxy)benzoyl]amino]-2,7-dimethyl-8-oxooctan-4-yl]azanium |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H]([NH3+])C[C@@H](C)CNC(=O)c1ccccc1OCCCOC |
| InChI | InChI=1S/C25H43N3O5/c1-5-6-12-27-24(30)19(3)16-22(29)21(26)15-18(2)17-28-25(31)20-10-7-8-11-23(20)33-14-9-13-32-4/h7-8,10-11,18-19,21-22,29H,5-6,9,12-17,26H2,1-4H3,(H,27,30)(H,28,31)/p+1/t18-,19-,21+,22+/m1/s1 |
| InChIKey | HCEVFKSMFFEYMG-WKDRNLAYSA-O |
| XLogP | 1.77 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|