C15H23F2O7P2-3 — CID 44629685
[[(2E,6E)-12-fluoro-11-(fluoromethyl)-3,7-dimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate (PubChem CID 44629685) has the molecular formula C15H23F2O7P2-3 and a molecular weight of 415.29 g/mol. Its IUPAC name is [[(2E,6E)-12-fluoro-11-(fluoromethyl)-3,7-dimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate.
| Compound Name | [[(2E,6E)-12-fluoro-11-(fluoromethyl)-3,7-dimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 44629685 |
| Molecular Formula | C15H23F2O7P2-3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [[(2E,6E)-12-fluoro-11-(fluoromethyl)-3,7-dimethyldodeca-2,6,10-trienoxy]-oxidophosphoryl] phosphate |
| SMILES | C/C(=C\CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-])CCC=C(CF)CF |
| InChI | InChI=1S/C15H26F2O7P2/c1-13(7-4-8-15(11-16)12-17)5-3-6-14(2)9-10-23-26(21,22)24-25(18,19)20/h5,8-9H,3-4,6-7,10-12H2,1-2H3,(H,21,22)(H2,18,19,20)/p-3/b13-5+,14-9+ |
| InChIKey | PVNRGYDHHSWPHV-HJAIQHMZSA-K |
| XLogP | 2.64 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|