About 3-bromo-2,4-dimethyl-5-phenylthiophene
3-bromo-2,4-dimethyl-5-phenylthiophene (PubChem CID 44629772) has the molecular formula C12H11BrS
and a molecular weight of 267.19 g/mol. Its IUPAC name is 3-bromo-2,4-dimethyl-5-phenylthiophene.
Molecular Properties
| Compound Name | 3-bromo-2,4-dimethyl-5-phenylthiophene |
| PubChem CID | 44629772 |
| Molecular Formula | C12H11BrS |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 3-bromo-2,4-dimethyl-5-phenylthiophene |
| SMILES | Cc1sc(-c2ccccc2)c(C)c1Br |
| InChI | InChI=1S/C12H11BrS/c1-8-11(13)9(2)14-12(8)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | VJMJMLJTIYJVQY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2,4-dimethyl-5-phenylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4-dimethyl-5-phenylthiophene?
The IUPAC name of 3-bromo-2,4-dimethyl-5-phenylthiophene (CID 44629772) is 3-bromo-2,4-dimethyl-5-phenylthiophene.
What is the SMILES notation for 3-bromo-2,4-dimethyl-5-phenylthiophene?
The canonical SMILES for 3-bromo-2,4-dimethyl-5-phenylthiophene is Cc1sc(-c2ccccc2)c(C)c1Br.
What is the InChIKey of 3-bromo-2,4-dimethyl-5-phenylthiophene?
The InChIKey is VJMJMLJTIYJVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrS/c1-8-11(13)9(2)14-12(8)10-6-4-3-5-7-10/h3-7H,1-2H3.
What are the key properties of 3-bromo-2,4-dimethyl-5-phenylthiophene?
3-bromo-2,4-dimethyl-5-phenylthiophene has a molecular weight of 267.19 g/mol, XLogP of 4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-dimethyl-5-phenylthiophene is sourced from PubChem (CID 44629772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).