C36H39F9O9S3Si3 — CID 44629864
[4-[3,5-bis[4-(trifluoromethylsulfonyloxy)-3-trimethylsilylphenyl]phenyl]-2-trimethylsilylphenyl] trifluoromethanesulfonate (PubChem CID 44629864) has the molecular formula C36H39F9O9S3Si3 and a molecular weight of 967.14 g/mol. Its IUPAC name is [4-[3,5-bis[4-(trifluoromethylsulfonyloxy)-3-trimethylsilylphenyl]phenyl]-2-trimethylsilylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[3,5-bis[4-(trifluoromethylsulfonyloxy)-3-trimethylsilylphenyl]phenyl]-2-trimethylsilylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44629864 |
| Molecular Formula | C36H39F9O9S3Si3 |
| Molecular Weight | 967.14 g/mol |
| Exact Mass | 966.09 |
| IUPAC Name | [4-[3,5-bis[4-(trifluoromethylsulfonyloxy)-3-trimethylsilylphenyl]phenyl]-2-trimethylsilylphenyl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1cc(-c2cc(-c3ccc(OS(=O)(=O)C(F)(F)F)c([Si](C)(C)C)c3)cc(-c3ccc(OS(=O)(=O)C(F)(F)F)c([Si](C)(C)C)c3)c2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C36H39F9O9S3Si3/c1-58(2,3)31-19-22(10-13-28(31)52-55(46,47)34(37,38)39)25-16-26(23-11-14-29(32(20-23)59(4,5)6)53-56(48,49)35(40,41)42)18-27(17-25)24-12-15-30(33(21-24)60(7,8)9)54-57(50,51)36(43,44)45/h10-21H,1-9H3 |
| InChIKey | ZLEUXQBUQGSSOW-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.14 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|