About trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate
trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate (PubChem CID 44629905) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate |
| PubChem CID | 44629905 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@H]1C(=O)OCC |
| InChI | InChI=1S/C12H20O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h9-10H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | ZTUZDYWYNQDJKR-NXEZZACHSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate?
The IUPAC name of trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate (CID 44629905) is trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate?
The canonical SMILES for trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate is CCOC(=O)[C@@H]1CCCC[C@H]1C(=O)OCC.
What is the InChIKey of trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate?
The InChIKey is ZTUZDYWYNQDJKR-NXEZZACHSA-N. The full InChI is InChI=1S/C12H20O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h9-10H,3-8H2,1-2H3/t9-,10-/m1/s1.
What are the key properties of trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate?
trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate has a molecular weight of 228.29 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-diethyl (1R,2R)-cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 44629905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).