About tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride
tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 44629909) has the molecular formula C9H18ClNO2
and a molecular weight of 207.70 g/mol. Its IUPAC name is tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| PubChem CID | 44629909 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1.Cl |
| InChI | InChI=1S/C9H17NO2.ClH/c1-9(2,3)12-8(11)7-5-4-6-10-7;/h7,10H,4-6H2,1-3H3;1H/t7-;/m1./s1 |
| InChIKey | IUUYANMOEMBTBV-OGFXRTJISA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
The IUPAC name of tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride (CID 44629909) is tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride.
What is the SMILES notation for tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
The canonical SMILES for tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride is CC(C)(C)OC(=O)[C@H]1CCCN1.Cl.
What is the InChIKey of tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
The InChIKey is IUUYANMOEMBTBV-OGFXRTJISA-N. The full InChI is InChI=1S/C9H17NO2.ClH/c1-9(2,3)12-8(11)7-5-4-6-10-7;/h7,10H,4-6H2,1-3H3;1H/t7-;/m1./s1.
What are the key properties of tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride?
tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride is sourced from PubChem (CID 44629909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).