C19H22O9S — CID 44629956
methyl (2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 44629956) has the molecular formula C19H22O9S and a molecular weight of 426.44 g/mol. Its IUPAC name is methyl (2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 44629956 |
| Molecular Formula | C19H22O9S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | methyl (2R,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H](Sc2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H22O9S/c1-10(20)25-14-15(26-11(2)21)17(27-12(3)22)19(28-16(14)18(23)24-4)29-13-8-6-5-7-9-13/h5-9,14-17,19H,1-4H3/t14-,15-,16+,17-,19-/m0/s1 |
| InChIKey | AXUXNCRKZCBMKR-LVEJAMMSSA-N |
| XLogP | 1.47 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|