About bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium
bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium (PubChem CID 44630019) has the molecular formula C15H30F6N2O4S2
and a molecular weight of 480.54 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium |
| PubChem CID | 44630019 |
| Molecular Formula | C15H30F6N2O4S2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H30N.C2F6NO4S2/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-13H2,1-4H3;/q+1;-1 |
| InChIKey | XALVHDZWUBSWES-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium (CID 44630019) is bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium is CCCC[N+](C)(CCCC)CCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium?
The InChIKey is XALVHDZWUBSWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N.C2F6NO4S2/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-13H2,1-4H3;/q+1;-1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium?
bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium has a molecular weight of 480.54 g/mol, XLogP of 4.89, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;tributyl(methyl)azanium is sourced from PubChem (CID 44630019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).