About chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane
chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane (PubChem CID 44630080) has the molecular formula C9H28ClNSi3
and a molecular weight of 270.04 g/mol. Its IUPAC name is chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane.
Molecular Properties
| Compound Name | chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane |
| PubChem CID | 44630080 |
| Molecular Formula | C9H28ClNSi3 |
| Molecular Weight | 270.04 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane |
| SMILES | C[Si](C)(C)Cl.C[Si](C)(C)N[Si](C)(C)C |
| InChI | InChI=1S/C6H19NSi2.C3H9ClSi/c1-8(2,3)7-9(4,5)6;1-5(2,3)4/h7H,1-6H3;1-3H3 |
| InChIKey | XPMFWTBRILCBMR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.04 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
The IUPAC name of chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane (CID 44630080) is chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane.
What is the SMILES notation for chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
The canonical SMILES for chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane is C[Si](C)(C)Cl.C[Si](C)(C)N[Si](C)(C)C.
What is the InChIKey of chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
The InChIKey is XPMFWTBRILCBMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19NSi2.C3H9ClSi/c1-8(2,3)7-9(4,5)6;1-5(2,3)4/h7H,1-6H3;1-3H3.
What are the key properties of chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane has a molecular weight of 270.04 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(trimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane is sourced from PubChem (CID 44630080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).