C3H2F6O2 — CID 44630761
2,2-dideuteriooxy-1,1,1,3,3,3-hexafluoropropane (PubChem CID 44630761) has the molecular formula C3H2F6O2 and a molecular weight of 186.05 g/mol. Its IUPAC name is 2,2-dideuteriooxy-1,1,1,3,3,3-hexafluoropropane.
| Compound Name | 2,2-dideuteriooxy-1,1,1,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 44630761 |
| Molecular Formula | C3H2F6O2 |
| Molecular Weight | 186.05 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 2,2-dideuteriooxy-1,1,1,3,3,3-hexafluoropropane |
| SMILES | [2H]OC(O[2H])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3H2F6O2/c4-2(5,6)1(10,11)3(7,8)9/h10-11H/i10D,11D |
| InChIKey | AKVXSYUWYXOLMY-MIBQVNFTSA-N |
| XLogP | 0.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.05 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|