About 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride
4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride (PubChem CID 44630897) has the molecular formula C6H11ClN4O
and a molecular weight of 190.63 g/mol. Its IUPAC name is 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride |
| PubChem CID | 44630897 |
| Molecular Formula | C6H11ClN4O |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride |
| SMILES | CNC(=O)c1nn(C)cc1N.Cl |
| InChI | InChI=1S/C6H10N4O.ClH/c1-8-6(11)5-4(7)3-10(2)9-5;/h3H,7H2,1-2H3,(H,8,11);1H |
| InChIKey | ZCIAEJYACXJCRN-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride?
The IUPAC name of 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride (CID 44630897) is 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride.
What is the SMILES notation for 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride?
The canonical SMILES for 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride is CNC(=O)c1nn(C)cc1N.Cl.
What is the InChIKey of 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride?
The InChIKey is ZCIAEJYACXJCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O.ClH/c1-8-6(11)5-4(7)3-10(2)9-5;/h3H,7H2,1-2H3,(H,8,11);1H.
What are the key properties of 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride?
4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride has a molecular weight of 190.63 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,1-dimethylpyrazole-3-carboxamide;hydrochloride is sourced from PubChem (CID 44630897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).